C18H17Cl2NO3S — CID 26327318
(3-chlorophenyl)-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone (PubChem CID 26327318) has the molecular formula C18H17Cl2NO3S and a molecular weight of 398.31 g/mol. Its IUPAC name is (3-chlorophenyl)-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone.
| Compound Name | (3-chlorophenyl)-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 26327318 |
| Molecular Formula | C18H17Cl2NO3S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | (3-chlorophenyl)-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1)[C@@H]1CCCN(S(=O)(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C18H17Cl2NO3S/c19-15-7-3-5-13(11-15)18(22)14-6-4-10-21(12-14)25(23,24)17-9-2-1-8-16(17)20/h1-3,5,7-9,11,14H,4,6,10,12H2/t14-/m1/s1 |
| InChIKey | AYYRMMRCZISLHD-CQSZACIVSA-N |
| XLogP | 4.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |