C20H25ClN2O3S — CID 58702098
1,3,3a,4,7,7a-hexahydroisoindol-2-yl-[(3S)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone (PubChem CID 58702098) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is 1,3,3a,4,7,7a-hexahydroisoindol-2-yl-[(3S)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone.
| Compound Name | 1,3,3a,4,7,7a-hexahydroisoindol-2-yl-[(3S)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 58702098 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1,3,3a,4,7,7a-hexahydroisoindol-2-yl-[(3S)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]methanone |
| SMILES | O=C([C@H]1CCCN(S(=O)(=O)c2ccccc2Cl)C1)N1CC2CC=CCC2C1 |
| InChI | InChI=1S/C20H25ClN2O3S/c21-18-9-3-4-10-19(18)27(25,26)23-11-5-8-17(14-23)20(24)22-12-15-6-1-2-7-16(15)13-22/h1-4,9-10,15-17H,5-8,11-14H2/t15?,16?,17-/m0/s1 |
| InChIKey | DYCKYTYQSLQEHH-JCYILVPMSA-N |
| XLogP | 3.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|