C25H35ClN2O3S — CID 58702073
1-(2-chlorophenyl)sulfonyl-N-(3,5,7-trimethyl-1-adamantyl)piperidine-3-carboxamide (PubChem CID 58702073) has the molecular formula C25H35ClN2O3S and a molecular weight of 479.09 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-N-(3,5,7-trimethyl-1-adamantyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-N-(3,5,7-trimethyl-1-adamantyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 58702073 |
| Molecular Formula | C25H35ClN2O3S |
| Molecular Weight | 479.09 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-N-(3,5,7-trimethyl-1-adamantyl)piperidine-3-carboxamide |
| SMILES | CC12CC3(C)CC(C)(C1)CC(NC(=O)C1CCCN(S(=O)(=O)c4ccccc4Cl)C1)(C2)C3 |
| InChI | InChI=1S/C25H35ClN2O3S/c1-22-12-23(2)14-24(3,13-22)17-25(15-22,16-23)27-21(29)18-7-6-10-28(11-18)32(30,31)20-9-5-4-8-19(20)26/h4-5,8-9,18H,6-7,10-17H2,1-3H3,(H,27,29) |
| InChIKey | BIDVPFHFNADADT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.09 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |