C18H18ClNO5S2 — CID 42459950
methyl 3-[(3R)-3-(3-chlorobenzoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 42459950) has the molecular formula C18H18ClNO5S2 and a molecular weight of 427.93 g/mol. Its IUPAC name is methyl 3-[(3R)-3-(3-chlorobenzoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(3R)-3-(3-chlorobenzoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 42459950 |
| Molecular Formula | C18H18ClNO5S2 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | methyl 3-[(3R)-3-(3-chlorobenzoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCC[C@@H](C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H18ClNO5S2/c1-25-18(22)17-15(7-9-26-17)27(23,24)20-8-3-5-13(11-20)16(21)12-4-2-6-14(19)10-12/h2,4,6-7,9-10,13H,3,5,8,11H2,1H3/t13-/m1/s1 |
| InChIKey | CMNRVRIVDDFIIC-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |