C21H21ClN2O4 — CID 45169004
methyl 2-[[3-(3-chlorobenzoyl)piperidine-1-carbonyl]amino]benzoate (PubChem CID 45169004) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is methyl 2-[[3-(3-chlorobenzoyl)piperidine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[3-(3-chlorobenzoyl)piperidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 45169004 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | methyl 2-[[3-(3-chlorobenzoyl)piperidine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1CCCC(C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H21ClN2O4/c1-28-20(26)17-9-2-3-10-18(17)23-21(27)24-11-5-7-15(13-24)19(25)14-6-4-8-16(22)12-14/h2-4,6,8-10,12,15H,5,7,11,13H2,1H3,(H,23,27) |
| InChIKey | SKTIGPMRQCUMAT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |