C18H25N3O4 — CID 31015711
methyl 2-[[(3S)-3-morpholin-4-ylpiperidine-1-carbonyl]amino]benzoate (PubChem CID 31015711) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is methyl 2-[[(3S)-3-morpholin-4-ylpiperidine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[(3S)-3-morpholin-4-ylpiperidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 31015711 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | methyl 2-[[(3S)-3-morpholin-4-ylpiperidine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1CCC[C@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C18H25N3O4/c1-24-17(22)15-6-2-3-7-16(15)19-18(23)21-8-4-5-14(13-21)20-9-11-25-12-10-20/h2-3,6-7,14H,4-5,8-13H2,1H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | QCPYKRUJVLKJHF-AWEZNQCLSA-N |
| XLogP | 1.80 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |