C15H21N3O4 — CID 3830798
1-N-(2,5-dimethoxyphenyl)piperidine-1,4-dicarboxamide (PubChem CID 3830798) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-N-(2,5-dimethoxyphenyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(2,5-dimethoxyphenyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 3830798 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-N-(2,5-dimethoxyphenyl)piperidine-1,4-dicarboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)N2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C15H21N3O4/c1-21-11-3-4-13(22-2)12(9-11)17-15(20)18-7-5-10(6-8-18)14(16)19/h3-4,9-10H,5-8H2,1-2H3,(H2,16,19)(H,17,20) |
| InChIKey | DPSSGYBXAVVZGG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |