C16H20N4O5 — CID 121160046
N-(2,4-dimethoxyphenyl)-3-(2,5-dioxoimidazolidin-1-yl)pyrrolidine-1-carboxamide (PubChem CID 121160046) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(2,5-dioxoimidazolidin-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(2,5-dioxoimidazolidin-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 121160046 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(2,5-dioxoimidazolidin-1-yl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC(N3C(=O)CNC3=O)C2)c(OC)c1 |
| InChI | InChI=1S/C16H20N4O5/c1-24-11-3-4-12(13(7-11)25-2)18-16(23)19-6-5-10(9-19)20-14(21)8-17-15(20)22/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,17,22)(H,18,23) |
| InChIKey | JIXYBUSCDUCBLT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|