C16H18BrN3O4 — CID 121160255
3-[1-(2-bromo-5-methoxybenzoyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 121160255) has the molecular formula C16H18BrN3O4 and a molecular weight of 396.24 g/mol. Its IUPAC name is 3-[1-(2-bromo-5-methoxybenzoyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(2-bromo-5-methoxybenzoyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160255 |
| Molecular Formula | C16H18BrN3O4 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 3-[1-(2-bromo-5-methoxybenzoyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(Br)c(C(=O)N2CCC(N3C(=O)CNC3=O)CC2)c1 |
| InChI | InChI=1S/C16H18BrN3O4/c1-24-11-2-3-13(17)12(8-11)15(22)19-6-4-10(5-7-19)20-14(21)9-18-16(20)23/h2-3,8,10H,4-7,9H2,1H3,(H,18,23) |
| InChIKey | VZYPQURXKLJRRW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|