C18H24N4O5 — CID 121160487
N-[(3,4-dimethoxyphenyl)methyl]-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide (PubChem CID 121160487) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121160487 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2CCC(N3C(=O)CNC3=O)CC2)cc1OC |
| InChI | InChI=1S/C18H24N4O5/c1-26-14-4-3-12(9-15(14)27-2)10-19-17(24)21-7-5-13(6-8-21)22-16(23)11-20-18(22)25/h3-4,9,13H,5-8,10-11H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | WAGHHTUKMRCSSF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|