C16H19N3O5S — CID 121155304
N-[(3,4-dimethoxyphenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carboxamide (PubChem CID 121155304) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 121155304 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2CC(N3C(=O)CSC3=O)C2)cc1OC |
| InChI | InChI=1S/C16H19N3O5S/c1-23-12-4-3-10(5-13(12)24-2)6-17-15(21)18-7-11(8-18)19-14(20)9-25-16(19)22/h3-5,11H,6-9H2,1-2H3,(H,17,21) |
| InChIKey | UQTNPJGQVCMUJF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|