C14H21N3O3 — CID 95483224
N-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 95483224) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 95483224 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C14H21N3O3/c1-19-12-4-3-11(9-13(12)20-2)10-16-14(18)17-7-5-15-6-8-17/h3-4,9,15H,5-8,10H2,1-2H3,(H,16,18) |
| InChIKey | POEXLXJZWOCPMB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |