C15H22N2O3 — CID 108896757
N-[(3,4-dimethoxyphenyl)methyl]piperidine-1-carboxamide (PubChem CID 108896757) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]piperidine-1-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108896757 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]piperidine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C15H22N2O3/c1-19-13-7-6-12(10-14(13)20-2)11-16-15(18)17-8-4-3-5-9-17/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,16,18) |
| InChIKey | JQKYJEFYBIGYQC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |