C18H26N2O3 — CID 138052960
N-[(3-methoxy-4-propan-2-yloxyphenyl)methyl]-4-methylidenepiperidine-1-carboxamide (PubChem CID 138052960) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(3-methoxy-4-propan-2-yloxyphenyl)methyl]-4-methylidenepiperidine-1-carboxamide.
| Compound Name | N-[(3-methoxy-4-propan-2-yloxyphenyl)methyl]-4-methylidenepiperidine-1-carboxamide |
|---|---|
| PubChem CID | 138052960 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[(3-methoxy-4-propan-2-yloxyphenyl)methyl]-4-methylidenepiperidine-1-carboxamide |
| SMILES | C=C1CCN(C(=O)NCc2ccc(OC(C)C)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-13(2)23-16-6-5-15(11-17(16)22-4)12-19-18(21)20-9-7-14(3)8-10-20/h5-6,11,13H,3,7-10,12H2,1-2,4H3,(H,19,21) |
| InChIKey | UGDZFRLTDVHXEY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|