C17H24F2N2O4 — CID 51124414
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-ethoxypiperidine-1-carboxamide (PubChem CID 51124414) has the molecular formula C17H24F2N2O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-ethoxypiperidine-1-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-ethoxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 51124414 |
| Molecular Formula | C17H24F2N2O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-ethoxypiperidine-1-carboxamide |
| SMILES | CCOC1CCN(C(=O)NCc2ccc(OC(F)F)c(OC)c2)CC1 |
| InChI | InChI=1S/C17H24F2N2O4/c1-3-24-13-6-8-21(9-7-13)17(22)20-11-12-4-5-14(25-16(18)19)15(10-12)23-2/h4-5,10,13,16H,3,6-9,11H2,1-2H3,(H,20,22) |
| InChIKey | GCCXGAVHLVBXEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |