C14H17F2NO3 — CID 47009227
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 47009227) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 47009227 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | COc1cc(CNC(=O)C2CC2C)ccc1OC(F)F |
| InChI | InChI=1S/C14H17F2NO3/c1-8-5-10(8)13(18)17-7-9-3-4-11(20-14(15)16)12(6-9)19-2/h3-4,6,8,10,14H,5,7H2,1-2H3,(H,17,18) |
| InChIKey | GDRNRIRSYCLGRA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |