C19H28F2N2O3 — CID 8558997
2-(cyclooctylamino)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide (PubChem CID 8558997) has the molecular formula C19H28F2N2O3 and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-(cyclooctylamino)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide.
| Compound Name | 2-(cyclooctylamino)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8558997 |
| Molecular Formula | C19H28F2N2O3 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-(cyclooctylamino)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
| SMILES | COc1cc(CNC(=O)CNC2CCCCCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C19H28F2N2O3/c1-25-17-11-14(9-10-16(17)26-19(20)21)12-23-18(24)13-22-15-7-5-3-2-4-6-8-15/h9-11,15,19,22H,2-8,12-13H2,1H3,(H,23,24) |
| InChIKey | DWQCNEJTSADHNW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |