C19H27F2NO3 — CID 55656409
4-cyclohexyl-N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]butanamide (PubChem CID 55656409) has the molecular formula C19H27F2NO3 and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-cyclohexyl-N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]butanamide.
| Compound Name | 4-cyclohexyl-N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55656409 |
| Molecular Formula | C19H27F2NO3 |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-cyclohexyl-N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]butanamide |
| SMILES | COc1ccc(CNC(=O)CCCC2CCCCC2)cc1OC(F)F |
| InChI | InChI=1S/C19H27F2NO3/c1-24-16-11-10-15(12-17(16)25-19(20)21)13-22-18(23)9-5-8-14-6-3-2-4-7-14/h10-12,14,19H,2-9,13H2,1H3,(H,22,23) |
| InChIKey | RKFXUDIXTIJIJM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |