C17H24F2N2O5 — CID 9262125
tert-butyl N-[3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-oxopropyl]carbamate (PubChem CID 9262125) has the molecular formula C17H24F2N2O5 and a molecular weight of 374.38 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 9262125 |
| Molecular Formula | C17H24F2N2O5 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | tert-butyl N-[3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-oxopropyl]carbamate |
| SMILES | COc1cc(CNC(=O)CCNC(=O)OC(C)(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C17H24F2N2O5/c1-17(2,3)26-16(23)20-8-7-14(22)21-10-11-5-6-12(25-15(18)19)13(9-11)24-4/h5-6,9,15H,7-8,10H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | QCXFZUNBIYTASJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |