C19H21F2NO4 — CID 9261506
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3-methylphenoxy)propanamide (PubChem CID 9261506) has the molecular formula C19H21F2NO4 and a molecular weight of 365.38 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3-methylphenoxy)propanamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 9261506 |
| Molecular Formula | C19H21F2NO4 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3-methylphenoxy)propanamide |
| SMILES | COc1cc(CNC(=O)CCOc2cccc(C)c2)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2NO4/c1-13-4-3-5-15(10-13)25-9-8-18(23)22-12-14-6-7-16(26-19(20)21)17(11-14)24-2/h3-7,10-11,19H,8-9,12H2,1-2H3,(H,22,23) |
| InChIKey | TYHDSHYHXLMAPK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |