C16H19F2N3O5 — CID 9261752
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 9261752) has the molecular formula C16H19F2N3O5 and a molecular weight of 371.34 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 9261752 |
| Molecular Formula | C16H19F2N3O5 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | COc1cc(CNC(=O)CCCN2C(=O)CNC2=O)ccc1OC(F)F |
| InChI | InChI=1S/C16H19F2N3O5/c1-25-12-7-10(4-5-11(12)26-15(17)18)8-19-13(22)3-2-6-21-14(23)9-20-16(21)24/h4-5,7,15H,2-3,6,8-9H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | ZERYKOWOPYSXCM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|