C19H14Cl2F2N2O5 — CID 41497799
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide (PubChem CID 41497799) has the molecular formula C19H14Cl2F2N2O5 and a molecular weight of 459.23 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 41497799 |
| Molecular Formula | C19H14Cl2F2N2O5 |
| Molecular Weight | 459.23 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
| SMILES | COc1cc(CNC(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C19H14Cl2F2N2O5/c1-29-15-4-9(2-3-14(15)30-19(22)23)7-24-16(26)8-25-17(27)10-5-12(20)13(21)6-11(10)18(25)28/h2-6,19H,7-8H2,1H3,(H,24,26) |
| InChIKey | RQCXJYGDKATFFZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|