C17H15ClF3NO4 — CID 41498200
2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide (PubChem CID 41498200) has the molecular formula C17H15ClF3NO4 and a molecular weight of 389.76 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 41498200 |
| Molecular Formula | C17H15ClF3NO4 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
| SMILES | COc1cc(CNC(=O)COc2ccc(F)cc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C17H15ClF3NO4/c1-24-15-6-10(2-4-14(15)26-17(20)21)8-22-16(23)9-25-13-5-3-11(19)7-12(13)18/h2-7,17H,8-9H2,1H3,(H,22,23) |
| InChIKey | RNYPLOGYUHAWIC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |