C18H16F2N2O4 — CID 9261449
2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide (PubChem CID 9261449) has the molecular formula C18H16F2N2O4 and a molecular weight of 362.33 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 9261449 |
| Molecular Formula | C18H16F2N2O4 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]acetamide |
| SMILES | COc1cc(CNC(=O)COc2ccccc2C#N)ccc1OC(F)F |
| InChI | InChI=1S/C18H16F2N2O4/c1-24-16-8-12(6-7-15(16)26-18(19)20)10-22-17(23)11-25-14-5-3-2-4-13(14)9-21/h2-8,18H,10-11H2,1H3,(H,22,23) |
| InChIKey | JAAJPWSINPEKIT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |