C19H18F2N2O4 — CID 27781034
2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylacetamide (PubChem CID 27781034) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylacetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 27781034 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylacetamide |
| SMILES | COc1cc(CN(C)C(=O)COc2ccccc2C#N)ccc1OC(F)F |
| InChI | InChI=1S/C19H18F2N2O4/c1-23(18(24)12-26-15-6-4-3-5-14(15)10-22)11-13-7-8-16(27-19(20)21)17(9-13)25-2/h3-9,19H,11-12H2,1-2H3 |
| InChIKey | QPLMREZRYZISCE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |