C17H14Cl3F2NO4 — CID 27894841
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 27894841) has the molecular formula C17H14Cl3F2NO4 and a molecular weight of 440.66 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 27894841 |
| Molecular Formula | C17H14Cl3F2NO4 |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | COc1cc(CNC(=O)COc2cc(Cl)c(Cl)cc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C17H14Cl3F2NO4/c1-25-15-4-9(2-3-13(15)27-17(21)22)7-23-16(24)8-26-14-6-11(19)10(18)5-12(14)20/h2-6,17H,7-8H2,1H3,(H,23,24) |
| InChIKey | MGWLNONTCHUKDT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|