C19H20ClF2NO4 — CID 9482433
2-(2-chloro-5-methylphenoxy)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide (PubChem CID 9482433) has the molecular formula C19H20ClF2NO4 and a molecular weight of 399.82 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 9482433 |
| Molecular Formula | C19H20ClF2NO4 |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide |
| SMILES | COc1cc(CCNC(=O)COc2cc(C)ccc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C19H20ClF2NO4/c1-12-3-5-14(20)16(9-12)26-11-18(24)23-8-7-13-4-6-15(27-19(21)22)17(10-13)25-2/h3-6,9-10,19H,7-8,11H2,1-2H3,(H,23,24) |
| InChIKey | DDJHXSGRFFJZTL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |