C18H17ClF2N2O5 — CID 9013918
[2-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 9013918) has the molecular formula C18H17ClF2N2O5 and a molecular weight of 414.79 g/mol. Its IUPAC name is [2-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9013918 |
| Molecular Formula | C18H17ClF2N2O5 |
| Molecular Weight | 414.79 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [2-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | COc1cc(CCNC(=O)COC(=O)c2cccnc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C18H17ClF2N2O5/c1-26-14-9-11(4-5-13(14)28-18(20)21)6-8-22-15(24)10-27-17(25)12-3-2-7-23-16(12)19/h2-5,7,9,18H,6,8,10H2,1H3,(H,22,24) |
| InChIKey | MHLJFEWTBWBXCV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|