C18H16F5NO4 — CID 51117641
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 51117641) has the molecular formula C18H16F5NO4 and a molecular weight of 405.32 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 51117641 |
| Molecular Formula | C18H16F5NO4 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | COc1ccc(CNC(=O)COc2ccc(C(F)(F)F)cc2)cc1OC(F)F |
| InChI | InChI=1S/C18H16F5NO4/c1-26-14-7-2-11(8-15(14)28-17(19)20)9-24-16(25)10-27-13-5-3-12(4-6-13)18(21,22)23/h2-8,17H,9-10H2,1H3,(H,24,25) |
| InChIKey | JWLPJGHDRKEQHJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |