C17H13F6NO2 — CID 55772582
2-[4-(trifluoromethyl)phenoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 55772582) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[4-(trifluoromethyl)phenoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55772582 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F6NO2/c18-16(19,20)12-3-1-11(2-4-12)9-24-15(25)10-26-14-7-5-13(6-8-14)17(21,22)23/h1-8H,9-10H2,(H,24,25) |
| InChIKey | ONVJUFLZIWERLG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |