C18H27NO3 — CID 4794325
3-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]propanamide (PubChem CID 4794325) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 4794325 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)CCC2CCCCC2)cc1OC |
| InChI | InChI=1S/C18H27NO3/c1-21-16-10-8-15(12-17(16)22-2)13-19-18(20)11-9-14-6-4-3-5-7-14/h8,10,12,14H,3-7,9,11,13H2,1-2H3,(H,19,20) |
| InChIKey | OUNBJPZVGHXEDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |