C21H31NO4 — CID 51728001
3-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]propanamide (PubChem CID 51728001) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 3-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 51728001 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 3-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]propanamide |
| SMILES | COc1cc(CNC(=O)CCC2CCCC2)ccc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H31NO4/c1-24-20-13-17(8-10-19(20)26-15-18-7-4-12-25-18)14-22-21(23)11-9-16-5-2-3-6-16/h8,10,13,16,18H,2-7,9,11-12,14-15H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | TWTDIVSXVHIJHI-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |