C22H27NO5 — CID 51726174
N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-2-(2-methoxyphenyl)acetamide (PubChem CID 51726174) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51726174 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)NCc1ccc(OC[C@@H]2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C22H27NO5/c1-25-19-8-4-3-6-17(19)13-22(24)23-14-16-9-10-20(21(12-16)26-2)28-15-18-7-5-11-27-18/h3-4,6,8-10,12,18H,5,7,11,13-15H2,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | ZVXOHRASLOLIGT-SFHVURJKSA-N |
| XLogP | 3.12 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |