C18H27NO4S — CID 55839780
N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-2-propylsulfanylacetamide (PubChem CID 55839780) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-2-propylsulfanylacetamide.
| Compound Name | N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-2-propylsulfanylacetamide |
|---|---|
| PubChem CID | 55839780 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-2-propylsulfanylacetamide |
| SMILES | CCCSCC(=O)NCc1ccc(OCC2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C18H27NO4S/c1-3-9-24-13-18(20)19-11-14-6-7-16(17(10-14)21-2)23-12-15-5-4-8-22-15/h6-7,10,15H,3-5,8-9,11-13H2,1-2H3,(H,19,20) |
| InChIKey | ISHFXUYERNMCJD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|