C20H21F2NO4 — CID 42961589
2,5-difluoro-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide (PubChem CID 42961589) has the molecular formula C20H21F2NO4 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2,5-difluoro-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide.
| Compound Name | 2,5-difluoro-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 42961589 |
| Molecular Formula | C20H21F2NO4 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2,5-difluoro-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2cc(F)ccc2F)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C20H21F2NO4/c1-25-19-9-13(4-7-18(19)27-12-15-3-2-8-26-15)11-23-20(24)16-10-14(21)5-6-17(16)22/h4-7,9-10,15H,2-3,8,11-12H2,1H3,(H,23,24) |
| InChIKey | UDCXMLZUEVTHOA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |