C18H20BrNO4S — CID 55708262
5-bromo-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 55708262) has the molecular formula C18H20BrNO4S and a molecular weight of 426.33 g/mol. Its IUPAC name is 5-bromo-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55708262 |
| Molecular Formula | C18H20BrNO4S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 5-bromo-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | COc1cc(CNC(=O)c2ccc(Br)s2)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C18H20BrNO4S/c1-22-15-9-12(10-20-18(21)16-6-7-17(19)25-16)4-5-14(15)24-11-13-3-2-8-23-13/h4-7,9,13H,2-3,8,10-11H2,1H3,(H,20,21) |
| InChIKey | SFHLZOCPTZPYTM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |