C24H29NO6 — CID 55708051
3-(3,4-dimethoxyphenyl)-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 55708051) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55708051 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCc2ccc(OCC3CCCO3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H29NO6/c1-27-20-9-6-17(13-22(20)28-2)8-11-24(26)25-15-18-7-10-21(23(14-18)29-3)31-16-19-5-4-12-30-19/h6-11,13-14,19H,4-5,12,15-16H2,1-3H3,(H,25,26) |
| InChIKey | UEGALQYOMYIROT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|