C17H22N2O4S — CID 5231123
3-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethylcarbamothioyl)prop-2-enamide (PubChem CID 5231123) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethylcarbamothioyl)prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 5231123 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethylcarbamothioyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NC(=S)NCC2CCCO2)cc1OC |
| InChI | InChI=1S/C17H22N2O4S/c1-21-14-7-5-12(10-15(14)22-2)6-8-16(20)19-17(24)18-11-13-4-3-9-23-13/h5-8,10,13H,3-4,9,11H2,1-2H3,(H2,18,19,20,24) |
| InChIKey | PXPKDEIBHUOLNJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|