C23H27N3O6S — CID 3888767
[2-methoxy-4-[(oxolan-2-ylmethylcarbamothioylhydrazinylidene)methyl]phenyl] 3,5-dimethoxybenzoate (PubChem CID 3888767) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is [2-methoxy-4-[(oxolan-2-ylmethylcarbamothioylhydrazinylidene)methyl]phenyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-methoxy-4-[(oxolan-2-ylmethylcarbamothioylhydrazinylidene)methyl]phenyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 3888767 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | [2-methoxy-4-[(oxolan-2-ylmethylcarbamothioylhydrazinylidene)methyl]phenyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)Oc2ccc(C=NNC(=S)NCC3CCCO3)cc2OC)c1 |
| InChI | InChI=1S/C23H27N3O6S/c1-28-18-10-16(11-19(12-18)29-2)22(27)32-20-7-6-15(9-21(20)30-3)13-25-26-23(33)24-14-17-5-4-8-31-17/h6-7,9-13,17H,4-5,8,14H2,1-3H3,(H2,24,26,33) |
| InChIKey | SGIIJLXRDXZKGK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|