C21H24ClN3O3S — CID 5224152
1-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 5224152) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is 1-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 5224152 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1cc(C=NNC(=S)NCC2CCCO2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H24ClN3O3S/c1-26-20-11-15(12-24-25-21(29)23-13-17-6-4-10-27-17)8-9-19(20)28-14-16-5-2-3-7-18(16)22/h2-3,5,7-9,11-12,17H,4,6,10,13-14H2,1H3,(H2,23,25,29) |
| InChIKey | AKAPITIDQUEHBI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|