C14H18BrN3O3S — CID 135702262
1-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 135702262) has the molecular formula C14H18BrN3O3S and a molecular weight of 388.29 g/mol. Its IUPAC name is 1-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 135702262 |
| Molecular Formula | C14H18BrN3O3S |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 1-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1cc(/C=N/NC(=S)NC[C@H]2CCCO2)cc(Br)c1O |
| InChI | InChI=1S/C14H18BrN3O3S/c1-20-12-6-9(5-11(15)13(12)19)7-17-18-14(22)16-8-10-3-2-4-21-10/h5-7,10,19H,2-4,8H2,1H3,(H2,16,18,22)/b17-7+/t10-/m1/s1 |
| InChIKey | KKISSASEVKWBCE-LZUJDIRXSA-N |
| XLogP | 2.14 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|