C21H27BrN2O6 — CID 3273740
2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N,N'-bis(oxolan-2-ylmethyl)propanediamide (PubChem CID 3273740) has the molecular formula C21H27BrN2O6 and a molecular weight of 483.36 g/mol. Its IUPAC name is 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N,N'-bis(oxolan-2-ylmethyl)propanediamide.
| Compound Name | 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N,N'-bis(oxolan-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 3273740 |
| Molecular Formula | C21H27BrN2O6 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N,N'-bis(oxolan-2-ylmethyl)propanediamide |
| SMILES | COc1cc(C=C(C(=O)NCC2CCCO2)C(=O)NCC2CCCO2)cc(Br)c1O |
| InChI | InChI=1S/C21H27BrN2O6/c1-28-18-10-13(9-17(22)19(18)25)8-16(20(26)23-11-14-4-2-6-29-14)21(27)24-12-15-5-3-7-30-15/h8-10,14-15,25H,2-7,11-12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | JTCUYGAWMVGRAD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|