C17H20BrNO6 — CID 8656415
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 8656415) has the molecular formula C17H20BrNO6 and a molecular weight of 414.25 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8656415 |
| Molecular Formula | C17H20BrNO6 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC[C@H]2CCCO2)cc(Br)c1O |
| InChI | InChI=1S/C17H20BrNO6/c1-23-14-8-11(7-13(18)17(14)22)4-5-16(21)25-10-15(20)19-9-12-3-2-6-24-12/h4-5,7-8,12,22H,2-3,6,9-10H2,1H3,(H,19,20)/b5-4+/t12-/m1/s1 |
| InChIKey | STXZIDOTGCRQSR-ZYOFXKKJSA-N |
| XLogP | 2.01 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|