C18H22BrNO5 — CID 8656097
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 8656097) has the molecular formula C18H22BrNO5 and a molecular weight of 412.28 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8656097 |
| Molecular Formula | C18H22BrNO5 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)N2CCCC[C@H]2C)cc(Br)c1O |
| InChI | InChI=1S/C18H22BrNO5/c1-12-5-3-4-8-20(12)16(21)11-25-17(22)7-6-13-9-14(19)18(23)15(10-13)24-2/h6-7,9-10,12,23H,3-5,8,11H2,1-2H3/b7-6+/t12-/m1/s1 |
| InChIKey | JVSKHDMSAQFXKL-NNNHXZLVSA-N |
| XLogP | 3.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|