C17H22BrNO5 — CID 8656064
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 8656064) has the molecular formula C17H22BrNO5 and a molecular weight of 400.27 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8656064 |
| Molecular Formula | C17H22BrNO5 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)/C=C/c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C17H22BrNO5/c1-4-5-11(2)19-15(20)10-24-16(21)7-6-12-8-13(18)17(22)14(9-12)23-3/h6-9,11,22H,4-5,10H2,1-3H3,(H,19,20)/b7-6+/t11-/m1/s1 |
| InChIKey | LHYCPWIRBNRHKH-XUIVZRPNSA-N |
| XLogP | 3.02 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|