C16H19Cl2NO3 — CID 2528204
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 2528204) has the molecular formula C16H19Cl2NO3 and a molecular weight of 344.24 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2528204 |
| Molecular Formula | C16H19Cl2NO3 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2NO3/c1-3-4-11(2)19-15(20)10-22-16(21)8-6-12-5-7-13(17)14(18)9-12/h5-9,11H,3-4,10H2,1-2H3,(H,19,20)/b8-6+/t11-/m1/s1 |
| InChIKey | DHSICYYPTXEDOH-LXSSAFMLSA-N |
| XLogP | 3.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|