C16H20BrNO5 — CID 8656025
[2-(diethylamino)-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 8656025) has the molecular formula C16H20BrNO5 and a molecular weight of 386.24 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8656025 |
| Molecular Formula | C16H20BrNO5 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCN(CC)C(=O)COC(=O)/C=C/c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C16H20BrNO5/c1-4-18(5-2)14(19)10-23-15(20)7-6-11-8-12(17)16(21)13(9-11)22-3/h6-9,21H,4-5,10H2,1-3H3/b7-6+ |
| InChIKey | NWWDRXLMNVJEIJ-VOTSOKGWSA-N |
| XLogP | 2.59 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|