C11H12BrNO3 — CID 169482858
3-(3-bromo-5-ethoxy-4-hydroxyphenyl)prop-2-enamide (PubChem CID 169482858) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 3-(3-bromo-5-ethoxy-4-hydroxyphenyl)prop-2-enamide.
| Compound Name | 3-(3-bromo-5-ethoxy-4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 169482858 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-(3-bromo-5-ethoxy-4-hydroxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(C=CC(N)=O)cc(Br)c1O |
| InChI | InChI=1S/C11H12BrNO3/c1-2-16-9-6-7(3-4-10(13)14)5-8(12)11(9)15/h3-6,15H,2H2,1H3,(H2,13,14) |
| InChIKey | KXRWWMHIKNDIAS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|