C11H12BrNO3 — CID 170876558
(E)-3-(4-bromo-3,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 170876558) has the molecular formula C11H12BrNO3 and a molecular weight of 286.13 g/mol. Its IUPAC name is (E)-3-(4-bromo-3,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-bromo-3,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 170876558 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (E)-3-(4-bromo-3,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(N)=O)cc(OC)c1Br |
| InChI | InChI=1S/C11H12BrNO3/c1-15-8-5-7(3-4-10(13)14)6-9(16-2)11(8)12/h3-6H,1-2H3,(H2,13,14)/b4-3+ |
| InChIKey | DZYYZBAZEDBTAA-ONEGZZNKSA-N |
| XLogP | 1.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|