C19H19BrO5 — CID 53472962
(E)-1-(2-bromo-3,5-dimethoxyphenyl)-3-(3,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 53472962) has the molecular formula C19H19BrO5 and a molecular weight of 407.26 g/mol. Its IUPAC name is (E)-1-(2-bromo-3,5-dimethoxyphenyl)-3-(3,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-bromo-3,5-dimethoxyphenyl)-3-(3,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 53472962 |
| Molecular Formula | C19H19BrO5 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | (E)-1-(2-bromo-3,5-dimethoxyphenyl)-3-(3,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cc(OC)cc(OC)c2Br)cc(OC)c1 |
| InChI | InChI=1S/C19H19BrO5/c1-22-13-7-12(8-14(9-13)23-2)5-6-17(21)16-10-15(24-3)11-18(25-4)19(16)20/h5-11H,1-4H3/b6-5+ |
| InChIKey | RIWKMJWTUGZHCM-AATRIKPKSA-N |
| XLogP | 4.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|